C29H25N3O8S — CID 2871671
ethyl 5-(2,5-dimethoxyphenyl)-7-methyl-2-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 2871671) has the molecular formula C29H25N3O8S and a molecular weight of 575.60 g/mol. Its IUPAC name is ethyl 5-(2,5-dimethoxyphenyl)-7-methyl-2-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl 5-(2,5-dimethoxyphenyl)-7-methyl-2-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 2871671 |
| Molecular Formula | C29H25N3O8S |
| Molecular Weight | 575.60 g/mol |
| Exact Mass | 575.14 |
| IUPAC Name | ethyl 5-(2,5-dimethoxyphenyl)-7-methyl-2-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=c2sc(=Cc3ccc(-c4ccc([N+](=O)[O-])cc4)o3)c(=O)n2C1c1cc(OC)ccc1OC |
| InChI | InChI=1S/C29H25N3O8S/c1-5-39-28(34)25-16(2)30-29-31(26(25)21-14-19(37-3)10-13-23(21)38-4)27(33)24(41-29)15-20-11-12-22(40-20)17-6-8-18(9-7-17)32(35)36/h6-15,26H,5H2,1-4H3 |
| InChIKey | ZYWYYQRDIHCRNY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 135.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.60 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|