About 3-(6,6-dimethyl-4-oxooxan-3-yl)-3-hydroxy-1H-indol-2-one
3-(6,6-dimethyl-4-oxooxan-3-yl)-3-hydroxy-1H-indol-2-one (PubChem CID 2871826) has the molecular formula C15H17NO4
and a molecular weight of 275.30 g/mol. Its IUPAC name is 3-(6,6-dimethyl-4-oxooxan-3-yl)-3-hydroxy-1H-indol-2-one.
Molecular Properties
| Compound Name | 3-(6,6-dimethyl-4-oxooxan-3-yl)-3-hydroxy-1H-indol-2-one |
| PubChem CID | 2871826 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 3-(6,6-dimethyl-4-oxooxan-3-yl)-3-hydroxy-1H-indol-2-one |
| SMILES | CC1(C)CC(=O)C(C2(O)C(=O)Nc3ccccc32)CO1 |
| InChI | InChI=1S/C15H17NO4/c1-14(2)7-12(17)10(8-20-14)15(19)9-5-3-4-6-11(9)16-13(15)18/h3-6,10,19H,7-8H2,1-2H3,(H,16,18) |
| InChIKey | KZVVSRYIOMVFDW-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(6,6-dimethyl-4-oxooxan-3-yl)-3-hydroxy-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6,6-dimethyl-4-oxooxan-3-yl)-3-hydroxy-1H-indol-2-one?
The IUPAC name of 3-(6,6-dimethyl-4-oxooxan-3-yl)-3-hydroxy-1H-indol-2-one (CID 2871826) is 3-(6,6-dimethyl-4-oxooxan-3-yl)-3-hydroxy-1H-indol-2-one.
What is the SMILES notation for 3-(6,6-dimethyl-4-oxooxan-3-yl)-3-hydroxy-1H-indol-2-one?
The canonical SMILES for 3-(6,6-dimethyl-4-oxooxan-3-yl)-3-hydroxy-1H-indol-2-one is CC1(C)CC(=O)C(C2(O)C(=O)Nc3ccccc32)CO1.
What is the InChIKey of 3-(6,6-dimethyl-4-oxooxan-3-yl)-3-hydroxy-1H-indol-2-one?
The InChIKey is KZVVSRYIOMVFDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO4/c1-14(2)7-12(17)10(8-20-14)15(19)9-5-3-4-6-11(9)16-13(15)18/h3-6,10,19H,7-8H2,1-2H3,(H,16,18).
What are the key properties of 3-(6,6-dimethyl-4-oxooxan-3-yl)-3-hydroxy-1H-indol-2-one?
3-(6,6-dimethyl-4-oxooxan-3-yl)-3-hydroxy-1H-indol-2-one has a molecular weight of 275.30 g/mol, XLogP of 1.21, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6,6-dimethyl-4-oxooxan-3-yl)-3-hydroxy-1H-indol-2-one is sourced from PubChem (CID 2871826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).