C30H27NO6S2 — CID 2871917
3-methoxy-4-[[4-[[2-methoxy-4-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]phenyl]methoxy]benzaldehyde (PubChem CID 2871917) has the molecular formula C30H27NO6S2 and a molecular weight of 561.68 g/mol. Its IUPAC name is 3-methoxy-4-[[4-[[2-methoxy-4-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]phenyl]methoxy]benzaldehyde.
| Compound Name | 3-methoxy-4-[[4-[[2-methoxy-4-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]phenyl]methoxy]benzaldehyde |
|---|---|
| PubChem CID | 2871917 |
| Molecular Formula | C30H27NO6S2 |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.13 |
| IUPAC Name | 3-methoxy-4-[[4-[[2-methoxy-4-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]phenyl]methoxy]benzaldehyde |
| SMILES | C=CCN1C(=O)C(=Cc2ccc(OCc3ccc(COc4ccc(C=O)cc4OC)cc3)c(OC)c2)SC1=S |
| InChI | InChI=1S/C30H27NO6S2/c1-4-13-31-29(33)28(39-30(31)38)16-22-9-11-24(26(14-22)34-2)36-18-20-5-7-21(8-6-20)19-37-25-12-10-23(17-32)15-27(25)35-3/h4-12,14-17H,1,13,18-19H2,2-3H3 |
| InChIKey | SPZSWEZBDHDVTA-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|