About N-[1,3-benzodioxol-5-yl-(8-hydroxyquinolin-7-yl)methyl]benzamide
N-[1,3-benzodioxol-5-yl-(8-hydroxyquinolin-7-yl)methyl]benzamide (PubChem CID 2871979) has the molecular formula C24H18N2O4
and a molecular weight of 398.42 g/mol. Its IUPAC name is N-[1,3-benzodioxol-5-yl-(8-hydroxyquinolin-7-yl)methyl]benzamide.
Molecular Properties
| Compound Name | N-[1,3-benzodioxol-5-yl-(8-hydroxyquinolin-7-yl)methyl]benzamide |
| PubChem CID | 2871979 |
| Molecular Formula | C24H18N2O4 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | N-[1,3-benzodioxol-5-yl-(8-hydroxyquinolin-7-yl)methyl]benzamide |
| SMILES | O=C(NC(c1ccc2c(c1)OCO2)c1ccc2cccnc2c1O)c1ccccc1 |
| InChI | InChI=1S/C24H18N2O4/c27-23-18(10-8-15-7-4-12-25-22(15)23)21(26-24(28)16-5-2-1-3-6-16)17-9-11-19-20(13-17)30-14-29-19/h1-13,21,27H,14H2,(H,26,28) |
| InChIKey | IQPSMMFOEYJSBP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze N-[1,3-benzodioxol-5-yl-(8-hydroxyquinolin-7-yl)methyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1,3-benzodioxol-5-yl-(8-hydroxyquinolin-7-yl)methyl]benzamide?
The IUPAC name of N-[1,3-benzodioxol-5-yl-(8-hydroxyquinolin-7-yl)methyl]benzamide (CID 2871979) is N-[1,3-benzodioxol-5-yl-(8-hydroxyquinolin-7-yl)methyl]benzamide.
What is the SMILES notation for N-[1,3-benzodioxol-5-yl-(8-hydroxyquinolin-7-yl)methyl]benzamide?
The canonical SMILES for N-[1,3-benzodioxol-5-yl-(8-hydroxyquinolin-7-yl)methyl]benzamide is O=C(NC(c1ccc2c(c1)OCO2)c1ccc2cccnc2c1O)c1ccccc1.
What is the InChIKey of N-[1,3-benzodioxol-5-yl-(8-hydroxyquinolin-7-yl)methyl]benzamide?
The InChIKey is IQPSMMFOEYJSBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18N2O4/c27-23-18(10-8-15-7-4-12-25-22(15)23)21(26-24(28)16-5-2-1-3-6-16)17-9-11-19-20(13-17)30-14-29-19/h1-13,21,27H,14H2,(H,26,28).
What are the key properties of N-[1,3-benzodioxol-5-yl-(8-hydroxyquinolin-7-yl)methyl]benzamide?
N-[1,3-benzodioxol-5-yl-(8-hydroxyquinolin-7-yl)methyl]benzamide has a molecular weight of 398.42 g/mol, XLogP of 4.19, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1,3-benzodioxol-5-yl-(8-hydroxyquinolin-7-yl)methyl]benzamide is sourced from PubChem (CID 2871979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).