C18H26INO2 — CID 2872135
1-methyl-3-(7,9,11-trimethyl-2,4-dioxaspiro[5.5]undec-9-en-3-yl)pyridin-1-ium iodide (PubChem CID 2872135) has the molecular formula C18H26INO2 and a molecular weight of 415.32 g/mol. Its IUPAC name is 1-methyl-3-(7,9,11-trimethyl-2,4-dioxaspiro[5.5]undec-9-en-3-yl)pyridin-1-ium iodide.
| Compound Name | 1-methyl-3-(7,9,11-trimethyl-2,4-dioxaspiro[5.5]undec-9-en-3-yl)pyridin-1-ium iodide |
|---|---|
| PubChem CID | 2872135 |
| Molecular Formula | C18H26INO2 |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 1-methyl-3-(7,9,11-trimethyl-2,4-dioxaspiro[5.5]undec-9-en-3-yl)pyridin-1-ium iodide |
| SMILES | CC1=CC(C)C2(COC(c3ccc[n+](C)c3)OC2)C(C)C1.[I-] |
| InChI | InChI=1S/C18H26NO2.HI/c1-13-8-14(2)18(15(3)9-13)11-20-17(21-12-18)16-6-5-7-19(4)10-16;/h5-8,10,14-15,17H,9,11-12H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | ZIVOUMZVBILBGE-UHFFFAOYSA-M |
| XLogP | 0.17 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|