About 1-hydroxy-2,2-dimethyl-3-(4-methylphenyl)-4-oxido-1-aza-4-azoniaspiro[4.5]dec-3-en-6-one
1-hydroxy-2,2-dimethyl-3-(4-methylphenyl)-4-oxido-1-aza-4-azoniaspiro[4.5]dec-3-en-6-one (PubChem CID 2872147) has the molecular formula C17H22N2O3
and a molecular weight of 302.37 g/mol. Its IUPAC name is 1-hydroxy-2,2-dimethyl-3-(4-methylphenyl)-4-oxido-1-aza-4-azoniaspiro[4.5]dec-3-en-6-one.
Molecular Properties
| Compound Name | 1-hydroxy-2,2-dimethyl-3-(4-methylphenyl)-4-oxido-1-aza-4-azoniaspiro[4.5]dec-3-en-6-one |
| PubChem CID | 2872147 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 1-hydroxy-2,2-dimethyl-3-(4-methylphenyl)-4-oxido-1-aza-4-azoniaspiro[4.5]dec-3-en-6-one |
| SMILES | Cc1ccc(C2=[N+]([O-])C3(CCCCC3=O)N(O)C2(C)C)cc1 |
| InChI | InChI=1S/C17H22N2O3/c1-12-7-9-13(10-8-12)15-16(2,3)19(22)17(18(15)21)11-5-4-6-14(17)20/h7-10,22H,4-6,11H2,1-3H3 |
| InChIKey | VZOBEMZKLQZTSU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-2,2-dimethyl-3-(4-methylphenyl)-4-oxido-1-aza-4-azoniaspiro[4.5]dec-3-en-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-2,2-dimethyl-3-(4-methylphenyl)-4-oxido-1-aza-4-azoniaspiro[4.5]dec-3-en-6-one?
The IUPAC name of 1-hydroxy-2,2-dimethyl-3-(4-methylphenyl)-4-oxido-1-aza-4-azoniaspiro[4.5]dec-3-en-6-one (CID 2872147) is 1-hydroxy-2,2-dimethyl-3-(4-methylphenyl)-4-oxido-1-aza-4-azoniaspiro[4.5]dec-3-en-6-one.
What is the SMILES notation for 1-hydroxy-2,2-dimethyl-3-(4-methylphenyl)-4-oxido-1-aza-4-azoniaspiro[4.5]dec-3-en-6-one?
The canonical SMILES for 1-hydroxy-2,2-dimethyl-3-(4-methylphenyl)-4-oxido-1-aza-4-azoniaspiro[4.5]dec-3-en-6-one is Cc1ccc(C2=[N+]([O-])C3(CCCCC3=O)N(O)C2(C)C)cc1.
What is the InChIKey of 1-hydroxy-2,2-dimethyl-3-(4-methylphenyl)-4-oxido-1-aza-4-azoniaspiro[4.5]dec-3-en-6-one?
The InChIKey is VZOBEMZKLQZTSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O3/c1-12-7-9-13(10-8-12)15-16(2,3)19(22)17(18(15)21)11-5-4-6-14(17)20/h7-10,22H,4-6,11H2,1-3H3.
What are the key properties of 1-hydroxy-2,2-dimethyl-3-(4-methylphenyl)-4-oxido-1-aza-4-azoniaspiro[4.5]dec-3-en-6-one?
1-hydroxy-2,2-dimethyl-3-(4-methylphenyl)-4-oxido-1-aza-4-azoniaspiro[4.5]dec-3-en-6-one has a molecular weight of 302.37 g/mol, XLogP of 2.62, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-2,2-dimethyl-3-(4-methylphenyl)-4-oxido-1-aza-4-azoniaspiro[4.5]dec-3-en-6-one is sourced from PubChem (CID 2872147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).