C8H10N6S4 — CID 2872826
5-[4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]but-2-enylsulfanyl]-1,3,4-thiadiazol-2-amine (PubChem CID 2872826) has the molecular formula C8H10N6S4 and a molecular weight of 318.48 g/mol. Its IUPAC name is 5-[4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]but-2-enylsulfanyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]but-2-enylsulfanyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 2872826 |
| Molecular Formula | C8H10N6S4 |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 317.98 |
| IUPAC Name | 5-[4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]but-2-enylsulfanyl]-1,3,4-thiadiazol-2-amine |
| SMILES | Nc1nnc(SCC=CCSc2nnc(N)s2)s1 |
| InChI | InChI=1S/C8H10N6S4/c9-5-11-13-7(17-5)15-3-1-2-4-16-8-14-12-6(10)18-8/h1-2H,3-4H2,(H2,9,11)(H2,10,12) |
| InChIKey | REUHNZDCGFQPCL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|