C17H26N6S — CID 28730321
5-[[4-(4-tert-butyltriazol-1-yl)piperidin-1-yl]methyl]-2-methylsulfanylpyrimidine (PubChem CID 28730321) has the molecular formula C17H26N6S and a molecular weight of 346.50 g/mol. Its IUPAC name is 5-[[4-(4-tert-butyltriazol-1-yl)piperidin-1-yl]methyl]-2-methylsulfanylpyrimidine.
| Compound Name | 5-[[4-(4-tert-butyltriazol-1-yl)piperidin-1-yl]methyl]-2-methylsulfanylpyrimidine |
|---|---|
| PubChem CID | 28730321 |
| Molecular Formula | C17H26N6S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 5-[[4-(4-tert-butyltriazol-1-yl)piperidin-1-yl]methyl]-2-methylsulfanylpyrimidine |
| SMILES | CSc1ncc(CN2CCC(n3cc(C(C)(C)C)nn3)CC2)cn1 |
| InChI | InChI=1S/C17H26N6S/c1-17(2,3)15-12-23(21-20-15)14-5-7-22(8-6-14)11-13-9-18-16(24-4)19-10-13/h9-10,12,14H,5-8,11H2,1-4H3 |
| InChIKey | PPJFMGCSEACHQC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |