C17H30N4O4S — CID 28732182
ethyl 4-[(3-butyl-2-ethylsulfonylimidazol-4-yl)methyl]piperazine-1-carboxylate (PubChem CID 28732182) has the molecular formula C17H30N4O4S and a molecular weight of 386.52 g/mol. Its IUPAC name is ethyl 4-[(3-butyl-2-ethylsulfonylimidazol-4-yl)methyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(3-butyl-2-ethylsulfonylimidazol-4-yl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 28732182 |
| Molecular Formula | C17H30N4O4S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | ethyl 4-[(3-butyl-2-ethylsulfonylimidazol-4-yl)methyl]piperazine-1-carboxylate |
| SMILES | CCCCn1c(CN2CCN(C(=O)OCC)CC2)cnc1S(=O)(=O)CC |
| InChI | InChI=1S/C17H30N4O4S/c1-4-7-8-21-15(13-18-16(21)26(23,24)6-3)14-19-9-11-20(12-10-19)17(22)25-5-2/h13H,4-12,14H2,1-3H3 |
| InChIKey | HYZJLUTYHXZGBL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |