C20H20ClNO2 — CID 2873248
2-(3-chlorophenyl)-3a,3b,4,5,6,7,8,9,9a,9b-decahydro-as-indaceno[4,5-c]pyrrole-1,3-dione (PubChem CID 2873248) has the molecular formula C20H20ClNO2 and a molecular weight of 341.84 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-3a,3b,4,5,6,7,8,9,9a,9b-decahydro-as-indaceno[4,5-c]pyrrole-1,3-dione.
| Compound Name | 2-(3-chlorophenyl)-3a,3b,4,5,6,7,8,9,9a,9b-decahydro-as-indaceno[4,5-c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 2873248 |
| Molecular Formula | C20H20ClNO2 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 2-(3-chlorophenyl)-3a,3b,4,5,6,7,8,9,9a,9b-decahydro-as-indaceno[4,5-c]pyrrole-1,3-dione |
| SMILES | O=C1C2C3CCCC3=C3CCCC3C2C(=O)N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H20ClNO2/c21-11-4-1-5-12(10-11)22-19(23)17-15-8-2-6-13(15)14-7-3-9-16(14)18(17)20(22)24/h1,4-5,10,15-18H,2-3,6-9H2 |
| InChIKey | KFWBPLWYFUKRBD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|