C15H24N6O — CID 28732816
[1-[[1-[(3-ethylimidazol-4-yl)methyl]piperidin-4-yl]methyl]triazol-4-yl]methanol (PubChem CID 28732816) has the molecular formula C15H24N6O and a molecular weight of 304.40 g/mol. Its IUPAC name is [1-[[1-[(3-ethylimidazol-4-yl)methyl]piperidin-4-yl]methyl]triazol-4-yl]methanol.
| Compound Name | [1-[[1-[(3-ethylimidazol-4-yl)methyl]piperidin-4-yl]methyl]triazol-4-yl]methanol |
|---|---|
| PubChem CID | 28732816 |
| Molecular Formula | C15H24N6O |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | [1-[[1-[(3-ethylimidazol-4-yl)methyl]piperidin-4-yl]methyl]triazol-4-yl]methanol |
| SMILES | CCn1cncc1CN1CCC(Cn2cc(CO)nn2)CC1 |
| InChI | InChI=1S/C15H24N6O/c1-2-20-12-16-7-15(20)10-19-5-3-13(4-6-19)8-21-9-14(11-22)17-18-21/h7,9,12-13,22H,2-6,8,10-11H2,1H3 |
| InChIKey | GHMHDMWHOOZFNH-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |