C19H21F3N2O — CID 28732920
(2S)-4-[(6-methyl-2-pyridinyl)methyl]-2-[[3-(trifluoromethyl)phenyl]methyl]morpholine (PubChem CID 28732920) has the molecular formula C19H21F3N2O and a molecular weight of 350.38 g/mol. Its IUPAC name is (2S)-4-[(6-methyl-2-pyridinyl)methyl]-2-[[3-(trifluoromethyl)phenyl]methyl]morpholine.
| Compound Name | (2S)-4-[(6-methyl-2-pyridinyl)methyl]-2-[[3-(trifluoromethyl)phenyl]methyl]morpholine |
|---|---|
| PubChem CID | 28732920 |
| Molecular Formula | C19H21F3N2O |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (2S)-4-[(6-methyl-2-pyridinyl)methyl]-2-[[3-(trifluoromethyl)phenyl]methyl]morpholine |
| SMILES | Cc1cccc(CN2CCO[C@@H](Cc3cccc(C(F)(F)F)c3)C2)n1 |
| InChI | InChI=1S/C19H21F3N2O/c1-14-4-2-7-17(23-14)12-24-8-9-25-18(13-24)11-15-5-3-6-16(10-15)19(20,21)22/h2-7,10,18H,8-9,11-13H2,1H3/t18-/m0/s1 |
| InChIKey | QKZQYPSNFUVITG-SFHVURJKSA-N |
| XLogP | 3.85 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |