C14H19N3O — CID 28733624
N-[2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethyl]-2-pyrazol-1-ylacetamide (PubChem CID 28733624) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is N-[2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethyl]-2-pyrazol-1-ylacetamide.
| Compound Name | N-[2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethyl]-2-pyrazol-1-ylacetamide |
|---|---|
| PubChem CID | 28733624 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | N-[2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethyl]-2-pyrazol-1-ylacetamide |
| SMILES | O=C(Cn1cccn1)NCC[C@@H]1C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C14H19N3O/c18-14(10-17-7-1-5-16-17)15-6-4-13-9-11-2-3-12(13)8-11/h1-3,5,7,11-13H,4,6,8-10H2,(H,15,18)/t11-,12+,13-/m1/s1 |
| InChIKey | ZLOMRRVQSNPZKT-FRRDWIJNSA-N |
| XLogP | 1.60 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|