C23H25BrN2O — CID 2873634
1-(4-methylphenyl)-2-(3-phenyl-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium-1-yl)ethanone bromide (PubChem CID 2873634) has the molecular formula C23H25BrN2O and a molecular weight of 425.37 g/mol. Its IUPAC name is 1-(4-methylphenyl)-2-(3-phenyl-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium-1-yl)ethanone bromide.
| Compound Name | 1-(4-methylphenyl)-2-(3-phenyl-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium-1-yl)ethanone bromide |
|---|---|
| PubChem CID | 2873634 |
| Molecular Formula | C23H25BrN2O |
| Molecular Weight | 425.37 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 1-(4-methylphenyl)-2-(3-phenyl-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium-1-yl)ethanone bromide |
| SMILES | Cc1ccc(C(=O)C[n+]2cc(-c3ccccc3)n3c2CCCCC3)cc1.[Br-] |
| InChI | InChI=1S/C23H25N2O.BrH/c1-18-11-13-20(14-12-18)22(26)17-24-16-21(19-8-4-2-5-9-19)25-15-7-3-6-10-23(24)25;/h2,4-5,8-9,11-14,16H,3,6-7,10,15,17H2,1H3;1H/q+1;/p-1 |
| InChIKey | WSKPYKXAYSMOBZ-UHFFFAOYSA-M |
| XLogP | 1.36 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.37 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|