C30H28N2O4 — CID 28740554
(1S,4S,8R,11S)-6,13-bis(2-ethylphenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-2,9-diene-5,7,12,14-tetrone (PubChem CID 28740554) has the molecular formula C30H28N2O4 and a molecular weight of 480.56 g/mol. Its IUPAC name is (1S,4S,8R,11S)-6,13-bis(2-ethylphenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-2,9-diene-5,7,12,14-tetrone.
| Compound Name | (1S,4S,8R,11S)-6,13-bis(2-ethylphenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-2,9-diene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 28740554 |
| Molecular Formula | C30H28N2O4 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | (1S,4S,8R,11S)-6,13-bis(2-ethylphenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-2,9-diene-5,7,12,14-tetrone |
| SMILES | CCc1ccccc1N1C(=O)[C@H]2C=C[C@@H]3C(=O)N(c4ccccc4CC)C(=O)[C@@H]4C=C[C@H](C1=O)C2C34 |
| InChI | InChI=1S/C30H28N2O4/c1-3-17-9-5-7-11-23(17)31-27(33)19-13-15-21-26-22(16-14-20(25(19)26)28(31)34)30(36)32(29(21)35)24-12-8-6-10-18(24)4-2/h5-16,19-22,25-26H,3-4H2,1-2H3/t19-,20-,21-,22+,25?,26?/m0/s1 |
| InChIKey | BCQNSNYEIMSSQX-YJASUKKPSA-N |
| XLogP | 4.09 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|