About 1,3-dimethyl-7-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]purine-2,6-dione
1,3-dimethyl-7-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]purine-2,6-dione (PubChem CID 2874437) has the molecular formula C19H21N7O5
and a molecular weight of 427.42 g/mol. Its IUPAC name is 1,3-dimethyl-7-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]purine-2,6-dione.
Molecular Properties
| Compound Name | 1,3-dimethyl-7-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]purine-2,6-dione |
| PubChem CID | 2874437 |
| Molecular Formula | C19H21N7O5 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 1,3-dimethyl-7-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2CC(=O)N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)n(C)c1=O |
| InChI | InChI=1S/C19H21N7O5/c1-21-17-16(18(28)22(2)19(21)29)25(12-20-17)11-15(27)24-9-7-23(8-10-24)13-3-5-14(6-4-13)26(30)31/h3-6,12H,7-11H2,1-2H3 |
| InChIKey | BGZYPADYURYJQJ-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 128.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethyl-7-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-7-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]purine-2,6-dione?
The IUPAC name of 1,3-dimethyl-7-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]purine-2,6-dione (CID 2874437) is 1,3-dimethyl-7-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]purine-2,6-dione.
What is the SMILES notation for 1,3-dimethyl-7-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]purine-2,6-dione?
The canonical SMILES for 1,3-dimethyl-7-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]purine-2,6-dione is Cn1c(=O)c2c(ncn2CC(=O)N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)n(C)c1=O.
What is the InChIKey of 1,3-dimethyl-7-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]purine-2,6-dione?
The InChIKey is BGZYPADYURYJQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N7O5/c1-21-17-16(18(28)22(2)19(21)29)25(12-20-17)11-15(27)24-9-7-23(8-10-24)13-3-5-14(6-4-13)26(30)31/h3-6,12H,7-11H2,1-2H3.
What are the key properties of 1,3-dimethyl-7-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]purine-2,6-dione?
1,3-dimethyl-7-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]purine-2,6-dione has a molecular weight of 427.42 g/mol, XLogP of -0.31, 4 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-7-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]purine-2,6-dione is sourced from PubChem (CID 2874437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).