2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)acetic acid

C7H10N2O3 — CID 28745776

IUPAC2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)acetic acid
SMILESCC1=NN(CC(=O)O)C(=O)CC1
InChIInChI=1S/C7H10N2O3/c1-5-2-3-6(10)9(8-5)4-7(11)12/h2-4H2,1H3,(H,11,12)
InChIKeyJGANTPYLXICDCN-UHFFFAOYSA-N
MW170.17 g/mol
LogP0.07
Rot. Bonds2

About 2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)acetic acid

2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)acetic acid (PubChem CID 28745776) has the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. Its IUPAC name is 2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)acetic acid.

Molecular Properties

Compound Name2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)acetic acid
PubChem CID28745776
Molecular FormulaC7H10N2O3
Molecular Weight170.17 g/mol
Exact Mass170.07
IUPAC Name2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)acetic acid
SMILESCC1=NN(CC(=O)O)C(=O)CC1
InChIInChI=1S/C7H10N2O3/c1-5-2-3-6(10)9(8-5)4-7(11)12/h2-4H2,1H3,(H,11,12)
InChIKeyJGANTPYLXICDCN-UHFFFAOYSA-N
XLogP0.07
TPSA69.97 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.17
LogP ≤ 50.07
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)acetic acid?
The IUPAC name of 2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)acetic acid (CID 28745776) is 2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)acetic acid.
What is the SMILES notation for 2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)acetic acid?
The canonical SMILES for 2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)acetic acid is CC1=NN(CC(=O)O)C(=O)CC1.
What is the InChIKey of 2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)acetic acid?
The InChIKey is JGANTPYLXICDCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3/c1-5-2-3-6(10)9(8-5)4-7(11)12/h2-4H2,1H3,(H,11,12).
What are the key properties of 2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)acetic acid?
2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)acetic acid has a molecular weight of 170.17 g/mol, XLogP of 0.07, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)acetic acid is sourced from PubChem (CID 28745776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).