C25H27BrN4O3 — CID 28747604
(5R)-5-(3-bromophenyl)-1-[2-(diethylamino)ethyl]-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]pyrrolidine-2,3-dione (PubChem CID 28747604) has the molecular formula C25H27BrN4O3 and a molecular weight of 511.42 g/mol. Its IUPAC name is (5R)-5-(3-bromophenyl)-1-[2-(diethylamino)ethyl]-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (5R)-5-(3-bromophenyl)-1-[2-(diethylamino)ethyl]-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 28747604 |
| Molecular Formula | C25H27BrN4O3 |
| Molecular Weight | 511.42 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | (5R)-5-(3-bromophenyl)-1-[2-(diethylamino)ethyl]-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]pyrrolidine-2,3-dione |
| SMILES | CCN(CC)CCN1C(=O)C(=O)C(=C(O)c2c(C)nc3ccccn23)[C@H]1c1cccc(Br)c1 |
| InChI | InChI=1S/C25H27BrN4O3/c1-4-28(5-2)13-14-30-22(17-9-8-10-18(26)15-17)20(24(32)25(30)33)23(31)21-16(3)27-19-11-6-7-12-29(19)21/h6-12,15,22,31H,4-5,13-14H2,1-3H3/t22-/m1/s1 |
| InChIKey | AVRIJGDVZNDQHU-JOCHJYFZSA-N |
| XLogP | 4.17 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.42 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|