C17H18N8O2S — CID 28748259
(4S,5R)-1,3-dimethyl-8-[(4-prop-2-enyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]-5,7-dihydro-4H-purine-2,6-dione (PubChem CID 28748259) has the molecular formula C17H18N8O2S and a molecular weight of 398.45 g/mol. Its IUPAC name is (4S,5R)-1,3-dimethyl-8-[(4-prop-2-enyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]-5,7-dihydro-4H-purine-2,6-dione.
| Compound Name | (4S,5R)-1,3-dimethyl-8-[(4-prop-2-enyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]-5,7-dihydro-4H-purine-2,6-dione |
|---|---|
| PubChem CID | 28748259 |
| Molecular Formula | C17H18N8O2S |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | (4S,5R)-1,3-dimethyl-8-[(4-prop-2-enyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]-5,7-dihydro-4H-purine-2,6-dione |
| SMILES | C=CCn1c(SC2=N[C@H]3[C@@H](N2)C(=O)N(C)C(=O)N3C)nnc1-c1cccnc1 |
| InChI | InChI=1S/C17H18N8O2S/c1-4-8-25-12(10-6-5-7-18-9-10)21-22-16(25)28-15-19-11-13(20-15)23(2)17(27)24(3)14(11)26/h4-7,9,11,13H,1,8H2,2-3H3,(H,19,20)/t11-,13-/m1/s1 |
| InChIKey | BACHAZUGZQUHIO-DGCLKSJQSA-N |
| XLogP | 0.80 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|