About N-(3-aminopropyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide
N-(3-aminopropyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide (PubChem CID 28754128) has the molecular formula C8H16N4O2S
and a molecular weight of 232.31 g/mol. Its IUPAC name is N-(3-aminopropyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-(3-aminopropyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
| PubChem CID | 28754128 |
| Molecular Formula | C8H16N4O2S |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | N-(3-aminopropyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)NCCCN |
| InChI | InChI=1S/C8H16N4O2S/c1-6-8(7(2)12-11-6)15(13,14)10-5-3-4-9/h10H,3-5,9H2,1-2H3,(H,11,12) |
| InChIKey | YXWVSJPSLJSIKL-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-aminopropyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-aminopropyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide?
The IUPAC name of N-(3-aminopropyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide (CID 28754128) is N-(3-aminopropyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide.
What is the SMILES notation for N-(3-aminopropyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide?
The canonical SMILES for N-(3-aminopropyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide is Cc1n[nH]c(C)c1S(=O)(=O)NCCCN.
What is the InChIKey of N-(3-aminopropyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide?
The InChIKey is YXWVSJPSLJSIKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N4O2S/c1-6-8(7(2)12-11-6)15(13,14)10-5-3-4-9/h10H,3-5,9H2,1-2H3,(H,11,12).
What are the key properties of N-(3-aminopropyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide?
N-(3-aminopropyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide has a molecular weight of 232.31 g/mol, XLogP of -0.35, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-aminopropyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide is sourced from PubChem (CID 28754128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).