About N-(4-aminobutyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide
N-(4-aminobutyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide (PubChem CID 28754341) has the molecular formula C9H18N4O2S
and a molecular weight of 246.34 g/mol. Its IUPAC name is N-(4-aminobutyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-(4-aminobutyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
| PubChem CID | 28754341 |
| Molecular Formula | C9H18N4O2S |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | N-(4-aminobutyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)NCCCCN |
| InChI | InChI=1S/C9H18N4O2S/c1-7-9(8(2)13-12-7)16(14,15)11-6-4-3-5-10/h11H,3-6,10H2,1-2H3,(H,12,13) |
| InChIKey | UWEGGDDUSNKGPI-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(4-aminobutyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-aminobutyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide?
The IUPAC name of N-(4-aminobutyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide (CID 28754341) is N-(4-aminobutyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide.
What is the SMILES notation for N-(4-aminobutyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide?
The canonical SMILES for N-(4-aminobutyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide is Cc1n[nH]c(C)c1S(=O)(=O)NCCCCN.
What is the InChIKey of N-(4-aminobutyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide?
The InChIKey is UWEGGDDUSNKGPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4O2S/c1-7-9(8(2)13-12-7)16(14,15)11-6-4-3-5-10/h11H,3-6,10H2,1-2H3,(H,12,13).
What are the key properties of N-(4-aminobutyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide?
N-(4-aminobutyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide has a molecular weight of 246.34 g/mol, XLogP of 0.04, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-aminobutyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide is sourced from PubChem (CID 28754341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).