C14H17N5OS2 — CID 2875859
2-[[5-(dimethylaminomethylideneamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-methylphenyl)acetamide (PubChem CID 2875859) has the molecular formula C14H17N5OS2 and a molecular weight of 335.46 g/mol. Its IUPAC name is 2-[[5-(dimethylaminomethylideneamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[[5-(dimethylaminomethylideneamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 2875859 |
| Molecular Formula | C14H17N5OS2 |
| Molecular Weight | 335.46 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 2-[[5-(dimethylaminomethylideneamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CSc2nnc(N=CN(C)C)s2)cc1 |
| InChI | InChI=1S/C14H17N5OS2/c1-10-4-6-11(7-5-10)16-12(20)8-21-14-18-17-13(22-14)15-9-19(2)3/h4-7,9H,8H2,1-3H3,(H,16,20) |
| InChIKey | JQNGPAZPUVGMTG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 70.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|