C17H17NO3 — CID 28759682
3-[3-[(2-phenylacetyl)amino]phenyl]propanoic acid (PubChem CID 28759682) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is 3-[3-[(2-phenylacetyl)amino]phenyl]propanoic acid.
| Compound Name | 3-[3-[(2-phenylacetyl)amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 28759682 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 3-[3-[(2-phenylacetyl)amino]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1cccc(NC(=O)Cc2ccccc2)c1 |
| InChI | InChI=1S/C17H17NO3/c19-16(12-13-5-2-1-3-6-13)18-15-8-4-7-14(11-15)9-10-17(20)21/h1-8,11H,9-10,12H2,(H,18,19)(H,20,21) |
| InChIKey | ABCIDVMBTJIBEI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |