About ethyl 3-benzyl-1-ethyl-2-methylbenzimidazol-1-ium-5-carboxylate perchlorate
ethyl 3-benzyl-1-ethyl-2-methylbenzimidazol-1-ium-5-carboxylate perchlorate (PubChem CID 2876122) has the molecular formula C20H23ClN2O6
and a molecular weight of 422.87 g/mol. Its IUPAC name is ethyl 3-benzyl-1-ethyl-2-methylbenzimidazol-1-ium-5-carboxylate perchlorate.
Molecular Properties
| Compound Name | ethyl 3-benzyl-1-ethyl-2-methylbenzimidazol-1-ium-5-carboxylate perchlorate |
| PubChem CID | 2876122 |
| Molecular Formula | C20H23ClN2O6 |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | ethyl 3-benzyl-1-ethyl-2-methylbenzimidazol-1-ium-5-carboxylate perchlorate |
| SMILES | CCOC(=O)c1ccc2c(c1)n(Cc1ccccc1)c(C)[n+]2CC.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C20H23N2O2.ClHO4/c1-4-21-15(3)22(14-16-9-7-6-8-10-16)19-13-17(11-12-18(19)21)20(23)24-5-2;2-1(3,4)5/h6-13H,4-5,14H2,1-3H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | DNESHGOQXDBVRF-UHFFFAOYSA-M |
| XLogP | -1.27 |
| TPSA | 127.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-benzyl-1-ethyl-2-methylbenzimidazol-1-ium-5-carboxylate perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-benzyl-1-ethyl-2-methylbenzimidazol-1-ium-5-carboxylate perchlorate?
The IUPAC name of ethyl 3-benzyl-1-ethyl-2-methylbenzimidazol-1-ium-5-carboxylate perchlorate (CID 2876122) is ethyl 3-benzyl-1-ethyl-2-methylbenzimidazol-1-ium-5-carboxylate perchlorate.
What is the SMILES notation for ethyl 3-benzyl-1-ethyl-2-methylbenzimidazol-1-ium-5-carboxylate perchlorate?
The canonical SMILES for ethyl 3-benzyl-1-ethyl-2-methylbenzimidazol-1-ium-5-carboxylate perchlorate is CCOC(=O)c1ccc2c(c1)n(Cc1ccccc1)c(C)[n+]2CC.[O-][Cl+3]([O-])([O-])[O-].
What is the InChIKey of ethyl 3-benzyl-1-ethyl-2-methylbenzimidazol-1-ium-5-carboxylate perchlorate?
The InChIKey is DNESHGOQXDBVRF-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H23N2O2.ClHO4/c1-4-21-15(3)22(14-16-9-7-6-8-10-16)19-13-17(11-12-18(19)21)20(23)24-5-2;2-1(3,4)5/h6-13H,4-5,14H2,1-3H3;(H,2,3,4,5)/q+1;/p-1.
What are the key properties of ethyl 3-benzyl-1-ethyl-2-methylbenzimidazol-1-ium-5-carboxylate perchlorate?
ethyl 3-benzyl-1-ethyl-2-methylbenzimidazol-1-ium-5-carboxylate perchlorate has a molecular weight of 422.87 g/mol, XLogP of -1.27, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-benzyl-1-ethyl-2-methylbenzimidazol-1-ium-5-carboxylate perchlorate is sourced from PubChem (CID 2876122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).