C19H16N2O2 — CID 2876231
8-methoxy-4-(4-methoxyphenyl)-2,3-diazatricyclo[7.3.1.05,13]trideca-1(12),3,5(13),6,8,10-hexaene (PubChem CID 2876231) has the molecular formula C19H16N2O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is 8-methoxy-4-(4-methoxyphenyl)-2,3-diazatricyclo[7.3.1.05,13]trideca-1(12),3,5(13),6,8,10-hexaene.
| Compound Name | 8-methoxy-4-(4-methoxyphenyl)-2,3-diazatricyclo[7.3.1.05,13]trideca-1(12),3,5(13),6,8,10-hexaene |
|---|---|
| PubChem CID | 2876231 |
| Molecular Formula | C19H16N2O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 8-methoxy-4-(4-methoxyphenyl)-2,3-diazatricyclo[7.3.1.05,13]trideca-1(12),3,5(13),6,8,10-hexaene |
| SMILES | COc1ccc(C2=NNc3cccc4c(OC)ccc2c34)cc1 |
| InChI | InChI=1S/C19H16N2O2/c1-22-13-8-6-12(7-9-13)19-15-10-11-17(23-2)14-4-3-5-16(18(14)15)20-21-19/h3-11,20H,1-2H3 |
| InChIKey | KCIGTOXKSCCJQF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'naphth_amino_C(2)', 'substructure': 'N/A'} |
|---|