C8H16N2 — CID 2876391
2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazine (PubChem CID 2876391) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is 2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazine.
| Compound Name | 2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 2876391 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazine |
| SMILES | C1CCN2CCNCC2C1 |
| InChI | InChI=1S/C8H16N2/c1-2-5-10-6-4-9-7-8(10)3-1/h8-9H,1-7H2 |
| InChIKey | ONHPOXROAPYCGT-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |