C22H26N2O2 — CID 28765338
cis-(1R,3R)-1,2,2-trimethyl-1-N,3-N-diphenylcyclopentane-1,3-dicarboxamide (PubChem CID 28765338) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is cis-(1R,3R)-1,2,2-trimethyl-1-N,3-N-diphenylcyclopentane-1,3-dicarboxamide.
| Compound Name | cis-(1R,3R)-1,2,2-trimethyl-1-N,3-N-diphenylcyclopentane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 28765338 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | cis-(1R,3R)-1,2,2-trimethyl-1-N,3-N-diphenylcyclopentane-1,3-dicarboxamide |
| SMILES | CC1(C)[C@H](C(=O)Nc2ccccc2)CC[C@@]1(C)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C22H26N2O2/c1-21(2)18(19(25)23-16-10-6-4-7-11-16)14-15-22(21,3)20(26)24-17-12-8-5-9-13-17/h4-13,18H,14-15H2,1-3H3,(H,23,25)(H,24,26)/t18-,22-/m0/s1 |
| InChIKey | MZRSBIZYDPKVTD-AVRDEDQJSA-N |
| XLogP | 4.71 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |