C13H12F3NO — CID 2876560
6-(trifluoromethyl)-2,3,4,9-tetrahydro-1H-carbazol-1-ol (PubChem CID 2876560) has the molecular formula C13H12F3NO and a molecular weight of 255.24 g/mol. Its IUPAC name is 6-(trifluoromethyl)-2,3,4,9-tetrahydro-1H-carbazol-1-ol.
| Compound Name | 6-(trifluoromethyl)-2,3,4,9-tetrahydro-1H-carbazol-1-ol |
|---|---|
| PubChem CID | 2876560 |
| Molecular Formula | C13H12F3NO |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 6-(trifluoromethyl)-2,3,4,9-tetrahydro-1H-carbazol-1-ol |
| SMILES | OC1CCCc2c1[nH]c1ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C13H12F3NO/c14-13(15,16)7-4-5-10-9(6-7)8-2-1-3-11(18)12(8)17-10/h4-6,11,17-18H,1-3H2 |
| InChIKey | QXVSBXVZGHLOLU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |