C17H26ClNOS — CID 28766387
[4-[(2-chlorophenyl)methyl]-1-(3-methylsulfanylpropyl)piperidin-4-yl]methanol (PubChem CID 28766387) has the molecular formula C17H26ClNOS and a molecular weight of 327.92 g/mol. Its IUPAC name is [4-[(2-chlorophenyl)methyl]-1-(3-methylsulfanylpropyl)piperidin-4-yl]methanol.
| Compound Name | [4-[(2-chlorophenyl)methyl]-1-(3-methylsulfanylpropyl)piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 28766387 |
| Molecular Formula | C17H26ClNOS |
| Molecular Weight | 327.92 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | [4-[(2-chlorophenyl)methyl]-1-(3-methylsulfanylpropyl)piperidin-4-yl]methanol |
| SMILES | CSCCCN1CCC(CO)(Cc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C17H26ClNOS/c1-21-12-4-9-19-10-7-17(14-20,8-11-19)13-15-5-2-3-6-16(15)18/h2-3,5-6,20H,4,7-14H2,1H3 |
| InChIKey | RJUVPEXGJMIYAN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.92 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|