About N-[(3,4-dimethoxyphenyl)-(8-hydroxyquinolin-7-yl)methyl]-2-phenylacetamide
N-[(3,4-dimethoxyphenyl)-(8-hydroxyquinolin-7-yl)methyl]-2-phenylacetamide (PubChem CID 2877092) has the molecular formula C26H24N2O4
and a molecular weight of 428.49 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)-(8-hydroxyquinolin-7-yl)methyl]-2-phenylacetamide.
Molecular Properties
| Compound Name | N-[(3,4-dimethoxyphenyl)-(8-hydroxyquinolin-7-yl)methyl]-2-phenylacetamide |
| PubChem CID | 2877092 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)-(8-hydroxyquinolin-7-yl)methyl]-2-phenylacetamide |
| SMILES | COc1ccc(C(NC(=O)Cc2ccccc2)c2ccc3cccnc3c2O)cc1OC |
| InChI | InChI=1S/C26H24N2O4/c1-31-21-13-11-19(16-22(21)32-2)24(28-23(29)15-17-7-4-3-5-8-17)20-12-10-18-9-6-14-27-25(18)26(20)30/h3-14,16,24,30H,15H2,1-2H3,(H,28,29) |
| InChIKey | VDNADKRFAFQSPT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze N-[(3,4-dimethoxyphenyl)-(8-hydroxyquinolin-7-yl)methyl]-2-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,4-dimethoxyphenyl)-(8-hydroxyquinolin-7-yl)methyl]-2-phenylacetamide?
The IUPAC name of N-[(3,4-dimethoxyphenyl)-(8-hydroxyquinolin-7-yl)methyl]-2-phenylacetamide (CID 2877092) is N-[(3,4-dimethoxyphenyl)-(8-hydroxyquinolin-7-yl)methyl]-2-phenylacetamide.
What is the SMILES notation for N-[(3,4-dimethoxyphenyl)-(8-hydroxyquinolin-7-yl)methyl]-2-phenylacetamide?
The canonical SMILES for N-[(3,4-dimethoxyphenyl)-(8-hydroxyquinolin-7-yl)methyl]-2-phenylacetamide is COc1ccc(C(NC(=O)Cc2ccccc2)c2ccc3cccnc3c2O)cc1OC.
What is the InChIKey of N-[(3,4-dimethoxyphenyl)-(8-hydroxyquinolin-7-yl)methyl]-2-phenylacetamide?
The InChIKey is VDNADKRFAFQSPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24N2O4/c1-31-21-13-11-19(16-22(21)32-2)24(28-23(29)15-17-7-4-3-5-8-17)20-12-10-18-9-6-14-27-25(18)26(20)30/h3-14,16,24,30H,15H2,1-2H3,(H,28,29).
What are the key properties of N-[(3,4-dimethoxyphenyl)-(8-hydroxyquinolin-7-yl)methyl]-2-phenylacetamide?
N-[(3,4-dimethoxyphenyl)-(8-hydroxyquinolin-7-yl)methyl]-2-phenylacetamide has a molecular weight of 428.49 g/mol, XLogP of 4.41, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,4-dimethoxyphenyl)-(8-hydroxyquinolin-7-yl)methyl]-2-phenylacetamide is sourced from PubChem (CID 2877092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).