C15H17ClN2 — CID 28771174
N'-[(2-chlorophenyl)methyl]-N'-phenylethane-1,2-diamine (PubChem CID 28771174) has the molecular formula C15H17ClN2 and a molecular weight of 260.77 g/mol. Its IUPAC name is N'-[(2-chlorophenyl)methyl]-N'-phenylethane-1,2-diamine.
| Compound Name | N'-[(2-chlorophenyl)methyl]-N'-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 28771174 |
| Molecular Formula | C15H17ClN2 |
| Molecular Weight | 260.77 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | N'-[(2-chlorophenyl)methyl]-N'-phenylethane-1,2-diamine |
| SMILES | NCCN(Cc1ccccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C15H17ClN2/c16-15-9-5-4-6-13(15)12-18(11-10-17)14-7-2-1-3-8-14/h1-9H,10-12,17H2 |
| InChIKey | WTSMFYCDTROSNQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.77 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |