About N-(4-methyl-2-pyridinyl)-4-phenyl-1,3-thiazol-2-amine;hydrobromide
N-(4-methyl-2-pyridinyl)-4-phenyl-1,3-thiazol-2-amine;hydrobromide (PubChem CID 2877172) has the molecular formula C15H14BrN3S
and a molecular weight of 348.27 g/mol. Its IUPAC name is N-(4-methyl-2-pyridinyl)-4-phenyl-1,3-thiazol-2-amine;hydrobromide.
Molecular Properties
| Compound Name | N-(4-methyl-2-pyridinyl)-4-phenyl-1,3-thiazol-2-amine;hydrobromide |
| PubChem CID | 2877172 |
| Molecular Formula | C15H14BrN3S |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | N-(4-methyl-2-pyridinyl)-4-phenyl-1,3-thiazol-2-amine;hydrobromide |
| SMILES | Br.Cc1ccnc(Nc2nc(-c3ccccc3)cs2)c1 |
| InChI | InChI=1S/C15H13N3S.BrH/c1-11-7-8-16-14(9-11)18-15-17-13(10-19-15)12-5-3-2-4-6-12;/h2-10H,1H3,(H,16,17,18);1H |
| InChIKey | YWJBCJIGKJNRLN-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4-methyl-2-pyridinyl)-4-phenyl-1,3-thiazol-2-amine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methyl-2-pyridinyl)-4-phenyl-1,3-thiazol-2-amine;hydrobromide?
The IUPAC name of N-(4-methyl-2-pyridinyl)-4-phenyl-1,3-thiazol-2-amine;hydrobromide (CID 2877172) is N-(4-methyl-2-pyridinyl)-4-phenyl-1,3-thiazol-2-amine;hydrobromide.
What is the SMILES notation for N-(4-methyl-2-pyridinyl)-4-phenyl-1,3-thiazol-2-amine;hydrobromide?
The canonical SMILES for N-(4-methyl-2-pyridinyl)-4-phenyl-1,3-thiazol-2-amine;hydrobromide is Br.Cc1ccnc(Nc2nc(-c3ccccc3)cs2)c1.
What is the InChIKey of N-(4-methyl-2-pyridinyl)-4-phenyl-1,3-thiazol-2-amine;hydrobromide?
The InChIKey is YWJBCJIGKJNRLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3S.BrH/c1-11-7-8-16-14(9-11)18-15-17-13(10-19-15)12-5-3-2-4-6-12;/h2-10H,1H3,(H,16,17,18);1H.
What are the key properties of N-(4-methyl-2-pyridinyl)-4-phenyl-1,3-thiazol-2-amine;hydrobromide?
N-(4-methyl-2-pyridinyl)-4-phenyl-1,3-thiazol-2-amine;hydrobromide has a molecular weight of 348.27 g/mol, XLogP of 4.84, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methyl-2-pyridinyl)-4-phenyl-1,3-thiazol-2-amine;hydrobromide is sourced from PubChem (CID 2877172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).