About 4-N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine;hydrobromide
4-N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine;hydrobromide (PubChem CID 2877261) has the molecular formula C15H13Br2N3S
and a molecular weight of 427.17 g/mol. Its IUPAC name is 4-N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine;hydrobromide.
Molecular Properties
| Compound Name | 4-N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine;hydrobromide |
| PubChem CID | 2877261 |
| Molecular Formula | C15H13Br2N3S |
| Molecular Weight | 427.17 g/mol |
| Exact Mass | 424.92 |
| IUPAC Name | 4-N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine;hydrobromide |
| SMILES | Br.Nc1ccc(Nc2nc(-c3ccc(Br)cc3)cs2)cc1 |
| InChI | InChI=1S/C15H12BrN3S.BrH/c16-11-3-1-10(2-4-11)14-9-20-15(19-14)18-13-7-5-12(17)6-8-13;/h1-9H,17H2,(H,18,19);1H |
| InChIKey | KNQMTIAHXHXGSO-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.17 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine;hydrobromide?
The IUPAC name of 4-N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine;hydrobromide (CID 2877261) is 4-N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine;hydrobromide.
What is the SMILES notation for 4-N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine;hydrobromide?
The canonical SMILES for 4-N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine;hydrobromide is Br.Nc1ccc(Nc2nc(-c3ccc(Br)cc3)cs2)cc1.
What is the InChIKey of 4-N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine;hydrobromide?
The InChIKey is KNQMTIAHXHXGSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12BrN3S.BrH/c16-11-3-1-10(2-4-11)14-9-20-15(19-14)18-13-7-5-12(17)6-8-13;/h1-9H,17H2,(H,18,19);1H.
What are the key properties of 4-N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine;hydrobromide?
4-N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine;hydrobromide has a molecular weight of 427.17 g/mol, XLogP of 5.48, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine;hydrobromide is sourced from PubChem (CID 2877261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).