C15H18N2O — CID 28772700
N'-methyl-N'-(2-phenoxyphenyl)ethane-1,2-diamine (PubChem CID 28772700) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is N'-methyl-N'-(2-phenoxyphenyl)ethane-1,2-diamine.
| Compound Name | N'-methyl-N'-(2-phenoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 28772700 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | N'-methyl-N'-(2-phenoxyphenyl)ethane-1,2-diamine |
| SMILES | CN(CCN)c1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C15H18N2O/c1-17(12-11-16)14-9-5-6-10-15(14)18-13-7-3-2-4-8-13/h2-10H,11-12,16H2,1H3 |
| InChIKey | IPLMDDYZTDREFQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |