2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)-methylamino]acetic acid

C8H9N3O5 — CID 28773328

IUPAC2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)-methylamino]acetic acid
SMILESCN(CC(=O)O)C(=O)c1c[nH]c(=O)[nH]c1=O
InChIInChI=1S/C8H9N3O5/c1-11(3-5(12)13)7(15)4-2-9-8(16)10-6(4)14/h2H,3H2,1H3,(H,12,13)(H2,9,10,14,16)
InChIKeyQJBWNMFRKSUXQP-UHFFFAOYSA-N
MW227.18 g/mol
LogP-1.78
Rot. Bonds3

About 2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)-methylamino]acetic acid

2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)-methylamino]acetic acid (PubChem CID 28773328) has the molecular formula C8H9N3O5 and a molecular weight of 227.18 g/mol. Its IUPAC name is 2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)-methylamino]acetic acid.

Molecular Properties

Compound Name2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)-methylamino]acetic acid
PubChem CID28773328
Molecular FormulaC8H9N3O5
Molecular Weight227.18 g/mol
Exact Mass227.05
IUPAC Name2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)-methylamino]acetic acid
SMILESCN(CC(=O)O)C(=O)c1c[nH]c(=O)[nH]c1=O
InChIInChI=1S/C8H9N3O5/c1-11(3-5(12)13)7(15)4-2-9-8(16)10-6(4)14/h2H,3H2,1H3,(H,12,13)(H2,9,10,14,16)
InChIKeyQJBWNMFRKSUXQP-UHFFFAOYSA-N
XLogP-1.78
TPSA123.33 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.18
LogP ≤ 5-1.78
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)-methylamino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)-methylamino]acetic acid?
The IUPAC name of 2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)-methylamino]acetic acid (CID 28773328) is 2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)-methylamino]acetic acid.
What is the SMILES notation for 2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)-methylamino]acetic acid?
The canonical SMILES for 2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)-methylamino]acetic acid is CN(CC(=O)O)C(=O)c1c[nH]c(=O)[nH]c1=O.
What is the InChIKey of 2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)-methylamino]acetic acid?
The InChIKey is QJBWNMFRKSUXQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O5/c1-11(3-5(12)13)7(15)4-2-9-8(16)10-6(4)14/h2H,3H2,1H3,(H,12,13)(H2,9,10,14,16).
What are the key properties of 2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)-methylamino]acetic acid?
2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)-methylamino]acetic acid has a molecular weight of 227.18 g/mol, XLogP of -1.78, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)-methylamino]acetic acid is sourced from PubChem (CID 28773328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).