About (2S)-4-amino-2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-4-oxobutanoic acid
(2S)-4-amino-2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-4-oxobutanoic acid (PubChem CID 28773348) has the molecular formula C9H10N4O6
and a molecular weight of 270.20 g/mol. Its IUPAC name is (2S)-4-amino-2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-4-oxobutanoic acid.
Molecular Properties
| Compound Name | (2S)-4-amino-2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-4-oxobutanoic acid |
| PubChem CID | 28773348 |
| Molecular Formula | C9H10N4O6 |
| Molecular Weight | 270.20 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | (2S)-4-amino-2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-4-oxobutanoic acid |
| SMILES | NC(=O)C[C@H](NC(=O)c1c[nH]c(=O)[nH]c1=O)C(=O)O |
| InChI | InChI=1S/C9H10N4O6/c10-5(14)1-4(8(17)18)12-6(15)3-2-11-9(19)13-7(3)16/h2,4H,1H2,(H2,10,14)(H,12,15)(H,17,18)(H2,11,13,16,19)/t4-/m0/s1 |
| InChIKey | IPCQSYAPTUAVAY-BYPYZUCNSA-N |
| XLogP | -2.88 |
| TPSA | 175.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.20 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-4-amino-2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-amino-2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-4-oxobutanoic acid?
The IUPAC name of (2S)-4-amino-2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-4-oxobutanoic acid (CID 28773348) is (2S)-4-amino-2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-4-oxobutanoic acid.
What is the SMILES notation for (2S)-4-amino-2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-4-oxobutanoic acid?
The canonical SMILES for (2S)-4-amino-2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-4-oxobutanoic acid is NC(=O)C[C@H](NC(=O)c1c[nH]c(=O)[nH]c1=O)C(=O)O.
What is the InChIKey of (2S)-4-amino-2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-4-oxobutanoic acid?
The InChIKey is IPCQSYAPTUAVAY-BYPYZUCNSA-N. The full InChI is InChI=1S/C9H10N4O6/c10-5(14)1-4(8(17)18)12-6(15)3-2-11-9(19)13-7(3)16/h2,4H,1H2,(H2,10,14)(H,12,15)(H,17,18)(H2,11,13,16,19)/t4-/m0/s1.
What are the key properties of (2S)-4-amino-2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-4-oxobutanoic acid?
(2S)-4-amino-2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-4-oxobutanoic acid has a molecular weight of 270.20 g/mol, XLogP of -2.88, 5 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-amino-2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-4-oxobutanoic acid is sourced from PubChem (CID 28773348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).