About (2R)-2-[4-(trifluoromethyl)phenyl]-1,3-thiazolidine
(2R)-2-[4-(trifluoromethyl)phenyl]-1,3-thiazolidine (PubChem CID 28775424) has the molecular formula C10H10F3NS
and a molecular weight of 233.26 g/mol. Its IUPAC name is (2R)-2-[4-(trifluoromethyl)phenyl]-1,3-thiazolidine.
Molecular Properties
| Compound Name | (2R)-2-[4-(trifluoromethyl)phenyl]-1,3-thiazolidine |
| PubChem CID | 28775424 |
| Molecular Formula | C10H10F3NS |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | (2R)-2-[4-(trifluoromethyl)phenyl]-1,3-thiazolidine |
| SMILES | FC(F)(F)c1ccc([C@@H]2NCCS2)cc1 |
| InChI | InChI=1S/C10H10F3NS/c11-10(12,13)8-3-1-7(2-4-8)9-14-5-6-15-9/h1-4,9,14H,5-6H2/t9-/m1/s1 |
| InChIKey | YWKHWMITZAALJR-SECBINFHSA-N |
| XLogP | 3.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-[4-(trifluoromethyl)phenyl]-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[4-(trifluoromethyl)phenyl]-1,3-thiazolidine?
The IUPAC name of (2R)-2-[4-(trifluoromethyl)phenyl]-1,3-thiazolidine (CID 28775424) is (2R)-2-[4-(trifluoromethyl)phenyl]-1,3-thiazolidine.
What is the SMILES notation for (2R)-2-[4-(trifluoromethyl)phenyl]-1,3-thiazolidine?
The canonical SMILES for (2R)-2-[4-(trifluoromethyl)phenyl]-1,3-thiazolidine is FC(F)(F)c1ccc([C@@H]2NCCS2)cc1.
What is the InChIKey of (2R)-2-[4-(trifluoromethyl)phenyl]-1,3-thiazolidine?
The InChIKey is YWKHWMITZAALJR-SECBINFHSA-N. The full InChI is InChI=1S/C10H10F3NS/c11-10(12,13)8-3-1-7(2-4-8)9-14-5-6-15-9/h1-4,9,14H,5-6H2/t9-/m1/s1.
What are the key properties of (2R)-2-[4-(trifluoromethyl)phenyl]-1,3-thiazolidine?
(2R)-2-[4-(trifluoromethyl)phenyl]-1,3-thiazolidine has a molecular weight of 233.26 g/mol, XLogP of 3.04, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[4-(trifluoromethyl)phenyl]-1,3-thiazolidine is sourced from PubChem (CID 28775424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).