C11H10N6S2 — CID 2877714
4-methyl-5-[2-(pyrimidin-2-ylamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-amine (PubChem CID 2877714) has the molecular formula C11H10N6S2 and a molecular weight of 290.38 g/mol. Its IUPAC name is 4-methyl-5-[2-(pyrimidin-2-ylamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-amine.
| Compound Name | 4-methyl-5-[2-(pyrimidin-2-ylamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 2877714 |
| Molecular Formula | C11H10N6S2 |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 4-methyl-5-[2-(pyrimidin-2-ylamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-amine |
| SMILES | Cc1nc(N)sc1-c1csc(Nc2ncccn2)n1 |
| InChI | InChI=1S/C11H10N6S2/c1-6-8(19-9(12)15-6)7-5-18-11(16-7)17-10-13-3-2-4-14-10/h2-5H,1H3,(H2,12,15)(H,13,14,16,17) |
| InChIKey | FHVNBKUGDCJKHS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiazole_amine_A(4)', 'substructure': 'N/A'} |
|---|