C9H13N3O3S2 — CID 28777287
(2S)-4-methylsulfanyl-2-[(4-methylthiadiazole-5-carbonyl)amino]butanoic acid (PubChem CID 28777287) has the molecular formula C9H13N3O3S2 and a molecular weight of 275.36 g/mol. Its IUPAC name is (2S)-4-methylsulfanyl-2-[(4-methylthiadiazole-5-carbonyl)amino]butanoic acid.
| Compound Name | (2S)-4-methylsulfanyl-2-[(4-methylthiadiazole-5-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 28777287 |
| Molecular Formula | C9H13N3O3S2 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | (2S)-4-methylsulfanyl-2-[(4-methylthiadiazole-5-carbonyl)amino]butanoic acid |
| SMILES | CSCC[C@H](NC(=O)c1snnc1C)C(=O)O |
| InChI | InChI=1S/C9H13N3O3S2/c1-5-7(17-12-11-5)8(13)10-6(9(14)15)3-4-16-2/h6H,3-4H2,1-2H3,(H,10,13)(H,14,15)/t6-/m0/s1 |
| InChIKey | VFRBHWCWJUNOQF-LURJTMIESA-N |
| XLogP | 0.78 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |