C10H13NO4 — CID 28778124
2-[3-(furan-2-yl)propanoyl-methylamino]acetic acid (PubChem CID 28778124) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is 2-[3-(furan-2-yl)propanoyl-methylamino]acetic acid.
| Compound Name | 2-[3-(furan-2-yl)propanoyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 28778124 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2-[3-(furan-2-yl)propanoyl-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)C(=O)CCc1ccco1 |
| InChI | InChI=1S/C10H13NO4/c1-11(7-10(13)14)9(12)5-4-8-3-2-6-15-8/h2-3,6H,4-5,7H2,1H3,(H,13,14) |
| InChIKey | KKHRZSZZLMLAFS-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |