About N-[2-(4-fluorophenyl)ethyl]-3,4-dimethoxybenzamide
N-[2-(4-fluorophenyl)ethyl]-3,4-dimethoxybenzamide (PubChem CID 2877899) has the molecular formula C17H18FNO3
and a molecular weight of 303.33 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-3,4-dimethoxybenzamide.
Molecular Properties
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-3,4-dimethoxybenzamide |
| PubChem CID | 2877899 |
| Molecular Formula | C17H18FNO3 |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCc2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C17H18FNO3/c1-21-15-8-5-13(11-16(15)22-2)17(20)19-10-9-12-3-6-14(18)7-4-12/h3-8,11H,9-10H2,1-2H3,(H,19,20) |
| InChIKey | LYKGRDHQDYCMRL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(4-fluorophenyl)ethyl]-3,4-dimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4-fluorophenyl)ethyl]-3,4-dimethoxybenzamide?
The IUPAC name of N-[2-(4-fluorophenyl)ethyl]-3,4-dimethoxybenzamide (CID 2877899) is N-[2-(4-fluorophenyl)ethyl]-3,4-dimethoxybenzamide.
What is the SMILES notation for N-[2-(4-fluorophenyl)ethyl]-3,4-dimethoxybenzamide?
The canonical SMILES for N-[2-(4-fluorophenyl)ethyl]-3,4-dimethoxybenzamide is COc1ccc(C(=O)NCCc2ccc(F)cc2)cc1OC.
What is the InChIKey of N-[2-(4-fluorophenyl)ethyl]-3,4-dimethoxybenzamide?
The InChIKey is LYKGRDHQDYCMRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18FNO3/c1-21-15-8-5-13(11-16(15)22-2)17(20)19-10-9-12-3-6-14(18)7-4-12/h3-8,11H,9-10H2,1-2H3,(H,19,20).
What are the key properties of N-[2-(4-fluorophenyl)ethyl]-3,4-dimethoxybenzamide?
N-[2-(4-fluorophenyl)ethyl]-3,4-dimethoxybenzamide has a molecular weight of 303.33 g/mol, XLogP of 2.82, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4-fluorophenyl)ethyl]-3,4-dimethoxybenzamide is sourced from PubChem (CID 2877899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).