C11H18N2S — CID 28780749
N-[(2-methyl-1,3-thiazol-4-yl)methyl]cyclohexanamine (PubChem CID 28780749) has the molecular formula C11H18N2S and a molecular weight of 210.35 g/mol. Its IUPAC name is N-[(2-methyl-1,3-thiazol-4-yl)methyl]cyclohexanamine.
| Compound Name | N-[(2-methyl-1,3-thiazol-4-yl)methyl]cyclohexanamine |
|---|---|
| PubChem CID | 28780749 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | N-[(2-methyl-1,3-thiazol-4-yl)methyl]cyclohexanamine |
| SMILES | Cc1nc(CNC2CCCCC2)cs1 |
| InChI | InChI=1S/C11H18N2S/c1-9-13-11(8-14-9)7-12-10-5-3-2-4-6-10/h8,10,12H,2-7H2,1H3 |
| InChIKey | XUFHPNNKDFTGMP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |