C19H25FN2O5 — CID 2878137
(4-cyclohexylpiperazin-1-yl)-(3-fluorophenyl)methanone;oxalic acid (PubChem CID 2878137) has the molecular formula C19H25FN2O5 and a molecular weight of 380.42 g/mol. Its IUPAC name is (4-cyclohexylpiperazin-1-yl)-(3-fluorophenyl)methanone;oxalic acid.
| Compound Name | (4-cyclohexylpiperazin-1-yl)-(3-fluorophenyl)methanone;oxalic acid |
|---|---|
| PubChem CID | 2878137 |
| Molecular Formula | C19H25FN2O5 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | (4-cyclohexylpiperazin-1-yl)-(3-fluorophenyl)methanone;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=C(c1cccc(F)c1)N1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C17H23FN2O.C2H2O4/c18-15-6-4-5-14(13-15)17(21)20-11-9-19(10-12-20)16-7-2-1-3-8-16;3-1(4)2(5)6/h4-6,13,16H,1-3,7-12H2;(H,3,4)(H,5,6) |
| InChIKey | ZMTZLMSFSRDWOY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|