About 1-(1,3-thiazol-4-ylmethyl)piperidin-4-one
1-(1,3-thiazol-4-ylmethyl)piperidin-4-one (PubChem CID 28782292) has the molecular formula C9H12N2OS
and a molecular weight of 196.27 g/mol. Its IUPAC name is 1-(1,3-thiazol-4-ylmethyl)piperidin-4-one.
Molecular Properties
| Compound Name | 1-(1,3-thiazol-4-ylmethyl)piperidin-4-one |
| PubChem CID | 28782292 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 1-(1,3-thiazol-4-ylmethyl)piperidin-4-one |
| SMILES | O=C1CCN(Cc2cscn2)CC1 |
| InChI | InChI=1S/C9H12N2OS/c12-9-1-3-11(4-2-9)5-8-6-13-7-10-8/h6-7H,1-5H2 |
| InChIKey | RIXYMHMADJTMEB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1,3-thiazol-4-ylmethyl)piperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-thiazol-4-ylmethyl)piperidin-4-one?
The IUPAC name of 1-(1,3-thiazol-4-ylmethyl)piperidin-4-one (CID 28782292) is 1-(1,3-thiazol-4-ylmethyl)piperidin-4-one.
What is the SMILES notation for 1-(1,3-thiazol-4-ylmethyl)piperidin-4-one?
The canonical SMILES for 1-(1,3-thiazol-4-ylmethyl)piperidin-4-one is O=C1CCN(Cc2cscn2)CC1.
What is the InChIKey of 1-(1,3-thiazol-4-ylmethyl)piperidin-4-one?
The InChIKey is RIXYMHMADJTMEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2OS/c12-9-1-3-11(4-2-9)5-8-6-13-7-10-8/h6-7H,1-5H2.
What are the key properties of 1-(1,3-thiazol-4-ylmethyl)piperidin-4-one?
1-(1,3-thiazol-4-ylmethyl)piperidin-4-one has a molecular weight of 196.27 g/mol, XLogP of 1.31, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-thiazol-4-ylmethyl)piperidin-4-one is sourced from PubChem (CID 28782292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).