C13H13NO3 — CID 28782365
1-[3-[(5-methyl-1,2-oxazol-3-yl)methoxy]phenyl]ethanone (PubChem CID 28782365) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is 1-[3-[(5-methyl-1,2-oxazol-3-yl)methoxy]phenyl]ethanone.
| Compound Name | 1-[3-[(5-methyl-1,2-oxazol-3-yl)methoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 28782365 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 1-[3-[(5-methyl-1,2-oxazol-3-yl)methoxy]phenyl]ethanone |
| SMILES | CC(=O)c1cccc(OCc2cc(C)on2)c1 |
| InChI | InChI=1S/C13H13NO3/c1-9-6-12(14-17-9)8-16-13-5-3-4-11(7-13)10(2)15/h3-7H,8H2,1-2H3 |
| InChIKey | QHSMYVRTWNHHKP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |