About 5-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]-1,3-thiazol-2-amine
5-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]-1,3-thiazol-2-amine (PubChem CID 28782688) has the molecular formula C8H9N3OS2
and a molecular weight of 227.31 g/mol. Its IUPAC name is 5-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]-1,3-thiazol-2-amine |
| PubChem CID | 28782688 |
| Molecular Formula | C8H9N3OS2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.02 |
| IUPAC Name | 5-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]-1,3-thiazol-2-amine |
| SMILES | Cc1cc(CSc2cnc(N)s2)on1 |
| InChI | InChI=1S/C8H9N3OS2/c1-5-2-6(12-11-5)4-13-7-3-10-8(9)14-7/h2-3H,4H2,1H3,(H2,9,10) |
| InChIKey | QBAIHQLUDUUTTJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]-1,3-thiazol-2-amine?
The IUPAC name of 5-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]-1,3-thiazol-2-amine (CID 28782688) is 5-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]-1,3-thiazol-2-amine.
What is the SMILES notation for 5-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]-1,3-thiazol-2-amine?
The canonical SMILES for 5-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]-1,3-thiazol-2-amine is Cc1cc(CSc2cnc(N)s2)on1.
What is the InChIKey of 5-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]-1,3-thiazol-2-amine?
The InChIKey is QBAIHQLUDUUTTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3OS2/c1-5-2-6(12-11-5)4-13-7-3-10-8(9)14-7/h2-3H,4H2,1H3,(H2,9,10).
What are the key properties of 5-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]-1,3-thiazol-2-amine?
5-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]-1,3-thiazol-2-amine has a molecular weight of 227.31 g/mol, XLogP of 2.31, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]-1,3-thiazol-2-amine is sourced from PubChem (CID 28782688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).