C14H11BrN2O3 — CID 28782742
4-bromo-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]indole-2,3-dione (PubChem CID 28782742) has the molecular formula C14H11BrN2O3 and a molecular weight of 335.16 g/mol. Its IUPAC name is 4-bromo-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]indole-2,3-dione.
| Compound Name | 4-bromo-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 28782742 |
| Molecular Formula | C14H11BrN2O3 |
| Molecular Weight | 335.16 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | 4-bromo-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]indole-2,3-dione |
| SMILES | Cc1noc(C)c1CN1C(=O)C(=O)c2c(Br)cccc21 |
| InChI | InChI=1S/C14H11BrN2O3/c1-7-9(8(2)20-16-7)6-17-11-5-3-4-10(15)12(11)13(18)14(17)19/h3-5H,6H2,1-2H3 |
| InChIKey | DIUNJCYNNUDLJN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.16 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|