C12H8FN3O3 — CID 28782849
6-fluoro-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]indole-2,3-dione (PubChem CID 28782849) has the molecular formula C12H8FN3O3 and a molecular weight of 261.21 g/mol. Its IUPAC name is 6-fluoro-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]indole-2,3-dione.
| Compound Name | 6-fluoro-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 28782849 |
| Molecular Formula | C12H8FN3O3 |
| Molecular Weight | 261.21 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 6-fluoro-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]indole-2,3-dione |
| SMILES | Cc1noc(CN2C(=O)C(=O)c3ccc(F)cc32)n1 |
| InChI | InChI=1S/C12H8FN3O3/c1-6-14-10(19-15-6)5-16-9-4-7(13)2-3-8(9)11(17)12(16)18/h2-4H,5H2,1H3 |
| InChIKey | PAGBAJACUKEZIH-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.21 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|