About 6-fluoro-1-(1,3-thiazol-4-ylmethyl)indole-2,3-dione
6-fluoro-1-(1,3-thiazol-4-ylmethyl)indole-2,3-dione (PubChem CID 28782856) has the molecular formula C12H7FN2O2S
and a molecular weight of 262.26 g/mol. Its IUPAC name is 6-fluoro-1-(1,3-thiazol-4-ylmethyl)indole-2,3-dione.
Molecular Properties
| Compound Name | 6-fluoro-1-(1,3-thiazol-4-ylmethyl)indole-2,3-dione |
| PubChem CID | 28782856 |
| Molecular Formula | C12H7FN2O2S |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | 6-fluoro-1-(1,3-thiazol-4-ylmethyl)indole-2,3-dione |
| SMILES | O=C1C(=O)N(Cc2cscn2)c2cc(F)ccc21 |
| InChI | InChI=1S/C12H7FN2O2S/c13-7-1-2-9-10(3-7)15(12(17)11(9)16)4-8-5-18-6-14-8/h1-3,5-6H,4H2 |
| InChIKey | DCKRKIUTILXQDO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-1-(1,3-thiazol-4-ylmethyl)indole-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-1-(1,3-thiazol-4-ylmethyl)indole-2,3-dione?
The IUPAC name of 6-fluoro-1-(1,3-thiazol-4-ylmethyl)indole-2,3-dione (CID 28782856) is 6-fluoro-1-(1,3-thiazol-4-ylmethyl)indole-2,3-dione.
What is the SMILES notation for 6-fluoro-1-(1,3-thiazol-4-ylmethyl)indole-2,3-dione?
The canonical SMILES for 6-fluoro-1-(1,3-thiazol-4-ylmethyl)indole-2,3-dione is O=C1C(=O)N(Cc2cscn2)c2cc(F)ccc21.
What is the InChIKey of 6-fluoro-1-(1,3-thiazol-4-ylmethyl)indole-2,3-dione?
The InChIKey is DCKRKIUTILXQDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7FN2O2S/c13-7-1-2-9-10(3-7)15(12(17)11(9)16)4-8-5-18-6-14-8/h1-3,5-6H,4H2.
What are the key properties of 6-fluoro-1-(1,3-thiazol-4-ylmethyl)indole-2,3-dione?
6-fluoro-1-(1,3-thiazol-4-ylmethyl)indole-2,3-dione has a molecular weight of 262.26 g/mol, XLogP of 2.01, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-1-(1,3-thiazol-4-ylmethyl)indole-2,3-dione is sourced from PubChem (CID 28782856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).