C13H10FN3O3 — CID 28782875
1-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]-5-fluoroindole-2,3-dione (PubChem CID 28782875) has the molecular formula C13H10FN3O3 and a molecular weight of 275.24 g/mol. Its IUPAC name is 1-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]-5-fluoroindole-2,3-dione.
| Compound Name | 1-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]-5-fluoroindole-2,3-dione |
|---|---|
| PubChem CID | 28782875 |
| Molecular Formula | C13H10FN3O3 |
| Molecular Weight | 275.24 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 1-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]-5-fluoroindole-2,3-dione |
| SMILES | CCc1noc(CN2C(=O)C(=O)c3cc(F)ccc32)n1 |
| InChI | InChI=1S/C13H10FN3O3/c1-2-10-15-11(20-16-10)6-17-9-4-3-7(14)5-8(9)12(18)13(17)19/h3-5H,2,6H2,1H3 |
| InChIKey | NEYKGHCLTCMJIE-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.24 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|